UserName
Choose the brand aligned with your industry so we can best serve your needs.
For researchers, scientists, and technical professionals: Your one-stop shop for the complete range of laboratory, production, and safety products and services.
For healthcare professionals: Your proven destination for comprehensive diagnostic and clinical laboratory products and services.
2-(2-Pyridyl)-2-propylamine | Apollo Scientific US - Building Blocks | 52568-28-2 | MFCD08729302 | 136.198 | C8H12N2 | 95.000 | CC(C)(N)c1ccccn1 | 5g | 438637582
3-(Boc-amino)propyl bromide | ChemScene | 83948-53-2 | MFCD02683429 | 238.125 | C8H16BrNO2 | 95.000 | CC(C)(C)OC(=O)NCCCBr | 500g | 369603305
N,N -Disuccinimidyl carbonate 99.8% | Synthonix | 74124-79-1 | MFCD00009767 | 256.170 | C9H8N2O7 | 99.000 | O=C(ON1C(=O)CCC1=O)ON1C(=O)CCC1=O | 5g | 591915000
3-(Boc-amino)propyl bromide | ChemScene | 83948-53-2 | MFCD02683429 | 238.125 | C8H16BrNO2 | 95.000 | CC(C)(C)OC(=O)NCCCBr | 50g | 894452921
N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide | AA Blocks LLC | 957476-07-2 | MFCD30491289 | 420.418 | C20H24N2O8 | 0.000 | COc1cc(OC)c(NC(=O)C(=O)Nc2c(OC)cc(OC)cc2OC)c(OC)c1 | 5g | 761907295
1-(1-Ethoxyethyl)-1H-pyrazole | ≥97% | CAS 28791-95-9 | C7H12N2O | 250mg
1-(1-Ethoxyethyl)-1H-pyrazole | ≥97% | CAS 28791-95-9 | C7H12N2O | 1g
N,N-Bis(2-hydroxyethyl)tetradecanamide | AA Blocks LLC | 7545-23-5 | MFCD00152656 | 315.498 | C18H37NO3 | 0.000 | CCCCCCCCCCCCCC(=O)N(CCO)CCO | 250mg | 925041005
4-Bromo-1-(1-ethoxyethyl)-3 5-dimethyl-1H-pyrazole | ≥97% | CAS 2169460-30-2 | C9H15BrN2O | 500mg
4-Bromo-1-(1-ethoxyethyl)-3 5-dimethyl-1H-pyrazole | ≥97% | CAS 2169460-30-2 | C9H15BrN2O | 250mg
4-Bromo-1-(1-ethoxyethyl)-3 5-dimethyl-1H-pyrazole | ≥97% | CAS 2169460-30-2 | C9H15BrN2O | 5g
1-(1-Ethoxyethyl)-1H-pyrazole-5-carboxylic acid | ≥97% | CAS 2734773-47-6 | C8H12N2O3 | 250mg
Spermidine trihydrochloride >=98% (TLC) | Purity: >=98% (TLC) | Mol Wt: 254.63 | 334-50-9 | MFCD00012918 | 25G
Dimethylamine, picrate | Oakwood Chemical | 5827-83-8274.189 | C8H10N4O7 | 97.000 | CNC.Oc1c(cc(cc1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O | 25mg | 537713103
N,N-DIETHYLETHYLENEDIAMINE | AstaTech | 100-36-7 | MFCD00008176 | 116.208 | C6H16N2 | 95.000 | CCN(CC)CCN | 100g | 810529693